CAS 1205-09-0

2-[[(1-Phenylethylidene)amino]oxy]acetic acid

Description:

2-[[(1-Phenylethylidene)amino]oxy]acetic acid, with the CAS number 1205-09-0, is an organic compound characterized by its unique functional groups, including an amino group and an ether linkage. This compound features a phenylethylidene moiety, which contributes to its aromatic properties and potential reactivity. It is typically a white to off-white solid at room temperature and is soluble in polar solvents, which may include water and alcohols, depending on the specific conditions. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions, making it a potential candidate for various chemical syntheses and biological applications. Additionally, the compound may exhibit interesting biological activities due to its structural features, which could be explored in medicinal chemistry. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 2-[[(1-Phenylethylidene)amino]oxy]acetic acid represents a versatile compound with potential utility in both research and industrial contexts.

Formula: C₁₀H₁₁NO₃

InChI: InChI=1S/C10H11NO3/c1-8(11-14-7-10(12)13)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,12,13)

InChI key: InChIKey=RCSPUQDYCFCXCV-UHFFFAOYSA-N

SMILES: C(=NOCC(O)=O)(C)C1=CC=CC=C1

Synonyms:

• 2-[[(1-Phenylethylidene)amino]oxy]acetic acid
• Acetic acid, [[(α-methylbenzylidene)amino]oxy]-
• Acetic acid, [[(1-phenylethylidene)amino]oxy]-
• Acetic acid, 2-[[(1-phenylethylidene)amino]oxy]-

(Z)-2-(((1-phenylethylidene)amino)oxy)acetic acid

CAS: 1205-09-0

(Z)-2-(((1-phenylethylidene)amino)oxy)acetic acid

Purity: 95%

Molecular weight: 193.2g/mol

Ref: 54-OR1004764