CymitQuimica logo

CAS 1205-74-9

:

4-Bromo-3-oxo-N-phenylbutanamide

Description:
4-Bromo-3-oxo-N-phenylbutanamide, with the CAS number 1205-74-9, is an organic compound characterized by its amide functional group and a bromine substituent. This compound features a butanamide backbone, which includes a phenyl group attached to the nitrogen atom, contributing to its aromatic properties. The presence of the keto group (3-oxo) indicates that it has a carbonyl functionality, which can influence its reactivity and interactions with other molecules. The bromine atom enhances the compound's electrophilic character, making it potentially useful in various chemical reactions, including nucleophilic substitutions. In terms of physical properties, compounds of this nature typically exhibit moderate solubility in organic solvents and may have distinct melting and boiling points influenced by their molecular structure. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Overall, 4-Bromo-3-oxo-N-phenylbutanamide is a versatile compound with potential applications in synthetic organic chemistry and pharmaceuticals.
Formula:C10H10BrNO2
InChI:InChI=1/C10H10BrNO2/c11-7-9(13)6-10(14)12-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,14)
SMILES:c1ccc(cc1)N=C(CC(=O)CBr)O
Synonyms:
  • 4-Bromo-3-Oxobutyranilide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.