CymitQuimica logo

CAS 120512-38-1

:

α1,α3,α3,5-Tetramethyl-1,3-benzenediacetonitrile

Description:
α1,α3,α3,5-Tetramethyl-1,3-benzenediacetonitrile, with the CAS number 120512-38-1, is a chemical compound characterized by its unique structure, which includes a benzene ring substituted with multiple methyl groups and two acetonitrile functional groups. This compound typically exhibits properties associated with nitriles, such as moderate polarity and potential solubility in organic solvents. The presence of multiple methyl groups contributes to its steric bulk, which can influence its reactivity and interaction with other molecules. Additionally, the compound may display specific optical properties due to its aromatic nature. Its applications can range from use in organic synthesis to potential roles in materials science, depending on its reactivity and stability under various conditions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound represents a specialized structure within the realm of organic chemistry, with characteristics that may be leveraged in various chemical applications.
Formula:C14H16N2
InChI:InChI=1S/C14H16N2/c1-10-5-12(11(2)8-15)7-13(6-10)14(3,4)9-16/h5-7,11H,1-4H3
InChI key:InChIKey=WYIZCUPTSQDNTC-UHFFFAOYSA-N
SMILES:C(C#N)(C)(C)C1=CC(C(C#N)C)=CC(C)=C1
Synonyms:
  • α1,α3,α3,5-Tetramethyl-1,3-benzenediacetonitrile
  • 1,3-Benzenediacetonitrile, α1,α3,α3,5-tetramethyl-
  • 1,3-Benzenediacetonitrile, α,α,α′,5-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.