CymitQuimica logo

CAS 120516-61-2

:

Poly(1,8-diaminonaphthalene)

Description:
Poly(1,8-diaminonaphthalene) is a synthetic polymer characterized by its unique structure derived from the polymerization of 1,8-diaminonaphthalene monomers. This polymer exhibits notable properties such as high thermal stability, good mechanical strength, and excellent chemical resistance, making it suitable for various applications in materials science and engineering. Its structure, featuring naphthalene rings, contributes to its ability to form strong intermolecular interactions, which enhances its stability and performance in different environments. Additionally, poly(1,8-diaminonaphthalene) can exhibit conductive properties, making it of interest in electronic applications, such as organic semiconductors and sensors. The polymer's solubility can vary depending on the processing conditions and the presence of functional groups, which can be tailored to enhance its compatibility with other materials. Overall, poly(1,8-diaminonaphthalene) is a versatile polymer with potential applications in advanced materials, electronics, and coatings due to its distinctive chemical and physical properties.
Formula:(C10H10N2)x
InChI:InChI=1S/C10H10N2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H,11-12H2
InChI key:InChIKey=YFOOEYJGMMJJLS-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=CC=C2N)C=CC1
Synonyms:
  • 1,8-Naphthalenediamine, homopolymer
  • Poly(1,8-diaminonaphthalene)
  • 1,8-Diaminonaphthalene homopolymer
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.