
CAS 120523-14-0
:(αR)-α-Methyl-1,3-benzodioxole-5-methanol
Description:
(αR)-α-Methyl-1,3-benzodioxole-5-methanol, identified by its CAS number 120523-14-0, is a chemical compound characterized by its unique structural features, which include a benzodioxole moiety and a hydroxymethyl group. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in organic solvents, depending on its functional groups. The presence of the hydroxymethyl group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other substances. Additionally, the stereochemistry indicated by the (αR) designation implies that it has specific spatial arrangements that can affect its biological activity and pharmacological properties. Compounds like this may be of interest in medicinal chemistry and materials science due to their potential applications in drug development or as intermediates in synthetic pathways. Overall, the characteristics of (αR)-α-Methyl-1,3-benzodioxole-5-methanol highlight its relevance in various chemical research fields.
Formula:C9H10O3
InChI:InChI=1S/C9H10O3/c1-6(10)7-2-3-8-9(4-7)12-5-11-8/h2-4,6,10H,5H2,1H3/t6-/m1/s1
InChI key:InChIKey=ZHKALZZEGVFZQA-ZCFIWIBFSA-N
SMILES:[C@H](C)(O)C=1C=C2C(=CC1)OCO2
Synonyms:- (1R)-1-(2H-1,3-Benzodioxol-5-yl)ethan-1-ol
- (αR)-α-Methyl-1,3-benzodioxole-5-methanol
- 1,3-Benzodioxole-5-methanol, α-methyl-, (αR)-
- (R)-1-(Benzo[d][1,3]dioxol-5-yl)ethan-1-ol
- 1,3-Benzodioxole-5-methanol, α-methyl-, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.