CAS 120523-16-2
:(R)-4-Chromanol
Description:
(R)-4-Chromanol, with the CAS number 120523-16-2, is a chiral compound belonging to the class of chroman derivatives. It features a chromanol structure, which consists of a chromane ring with a hydroxyl group (-OH) at the 4-position, contributing to its properties as a phenolic compound. This substance is characterized by its potential antioxidant activity, which is attributed to the presence of the hydroxyl group that can donate electrons and neutralize free radicals. (R)-4-Chromanol is of interest in various fields, including pharmaceuticals and food chemistry, due to its potential health benefits and applications in formulations. The stereochemistry of the compound is significant, as the (R) configuration can influence its biological activity and interactions with other molecules. Additionally, (R)-4-Chromanol may exhibit solubility in organic solvents and varying degrees of stability depending on environmental conditions. Its synthesis and characterization are important for understanding its reactivity and potential applications in medicinal chemistry and related areas.
Formula:C9H10O2
InChI:InChI=1S/C9H10O2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-4,8,10H,5-6H2/t8-/m1/s1
InChI key:InChIKey=MGSHXMOLUWTMGP-MRVPVSSYSA-N
SMILES:O[C@H]1C=2C(OCC1)=CC=CC2
Synonyms:- (4R)-3,4-Dihydro-2H-1-benzopyran-4-ol
- (R)-4-Chromanol
- 2H-1-Benzopyran-4-ol, 3,4-dihydro-, (4R)-
- 2H-1-Benzopyran-4-ol, 3,4-dihydro-, (R)-
- (4R)-3,4-Dihydro-2H-chromen-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.