CAS 120537-47-5
:1-benzyl-N,N-dimethyl-1H-imidazo[4,5-c]pyridin-4-amine
Description:
1-Benzyl-N,N-dimethyl-1H-imidazo[4,5-c]pyridin-4-amine is a chemical compound characterized by its complex heterocyclic structure, which includes an imidazole ring fused to a pyridine moiety. This compound features a benzyl group and two dimethyl groups attached to the nitrogen atoms, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the imidazo and pyridine rings suggests potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also display basic properties due to the nitrogen atoms in its structure, which can participate in protonation reactions. Its CAS number, 120537-47-5, allows for easy identification in chemical databases. Overall, this compound's structural features suggest it could be a candidate for further research in various chemical and biological applications.
Formula:C15H16N4
InChI:InChI=1/C15H16N4/c1-18(2)15-14-13(8-9-16-15)19(11-17-14)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3
SMILES:CN(C)c1c2c(ccn1)n(Cc1ccccc1)cn2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.