
CAS 1205556-97-3
:5-Chloro-1-[(3-methoxyphenyl)methyl]-1H-tetrazole
Description:
5-Chloro-1-[(3-methoxyphenyl)methyl]-1H-tetrazole is a chemical compound characterized by its tetrazole ring, which is a five-membered aromatic heterocycle containing four nitrogen atoms and one carbon atom. The presence of a chloro substituent at the 5-position of the tetrazole ring contributes to its reactivity and potential biological activity. The compound also features a 3-methoxyphenyl group attached via a methylene bridge, which can influence its solubility and interaction with biological targets. This structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anti-inflammatory properties. The methoxy group may enhance lipophilicity, aiding in membrane permeability. Additionally, the compound's unique combination of functional groups may allow for diverse chemical reactivity, making it a candidate for further synthetic modifications. As with many tetrazole derivatives, it may exhibit interesting pharmacological properties, warranting investigation in medicinal chemistry. Safety and handling precautions should be observed due to the presence of chlorine and the potential toxicity associated with tetrazole derivatives.
Formula:C9H9ClN4O
InChI:InChI=1S/C9H9ClN4O/c1-15-8-4-2-3-7(5-8)6-14-9(10)11-12-13-14/h2-5H,6H2,1H3
InChI key:InChIKey=GEUYADGMEXLUJL-UHFFFAOYSA-N
SMILES:C(N1C(Cl)=NN=N1)C2=CC(OC)=CC=C2
Synonyms:- 1H-Tetrazole, 5-chloro-1-[(3-methoxyphenyl)methyl]-
- 5-Chloro-1-[(3-methoxyphenyl)methyl]-1H-tetrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.