CAS 120568-18-5
:2-Butyl-4-chloro-1-[[2'-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-1H-imidazole-5-carboxaldehyde
Description:
2-Butyl-4-chloro-1-[[2'-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-1H-imidazole-5-carboxaldehyde is a complex organic compound characterized by its multi-functional structure, which includes an imidazole ring, a tetrazole moiety, and a biphenyl system. The presence of a butyl group and a chloro substituent contributes to its hydrophobic and potentially lipophilic properties, influencing its solubility and reactivity. The compound's imidazole and tetrazole rings suggest potential biological activity, as these structures are often found in pharmaceuticals and agrochemicals. The aldehyde functional group indicates reactivity, allowing for further chemical modifications or interactions. Its molecular architecture may facilitate interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the triphenylmethyl group can enhance stability and steric hindrance, affecting the compound's overall behavior in various environments. Overall, this compound exemplifies the complexity and diversity of organic molecules, with potential applications in drug development and chemical research.
Formula:C41H35ClN6O
InChI:InChI=1/C41H35ClN6O/c1-2-3-23-38-43-39(42)37(29-49)47(38)28-30-24-26-31(27-25-30)35-21-13-14-22-36(35)40-44-45-46-48(40)41(32-15-7-4-8-16-32,33-17-9-5-10-18-33)34-19-11-6-12-20-34/h4-22,24-27,29H,2-3,23,28H2,1H3
SMILES:CCCCc1nc(c(C=O)n1Cc1ccc(cc1)c1ccccc1c1nnnn1C(c1ccccc1)(c1ccccc1)c1ccccc1)Cl
Synonyms:- N-Trityl Losartan Carboxaldehyde
- 2-butyl-4-chloro-1-{[2'-(1-trityl-1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1H-imidazole-5-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
