CAS 1205683-33-5

1-(2-Phenoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole

Description:

1-(2-Phenoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a boron-containing dioxaborolane moiety. The presence of the phenoxyethyl group contributes to its potential solubility and reactivity, while the tetramethyl dioxaborolane structure may enhance its stability and reactivity in various chemical reactions, particularly in organoboron chemistry. This compound may exhibit interesting biological activities, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific interactions with solvents and other chemical entities. As with many boron-containing compounds, it may also participate in unique coordination chemistry, which could be exploited in various synthetic applications. Overall, this compound represents a versatile structure with potential implications in both synthetic and medicinal chemistry.

Formula: C₁₇H₂₃BN₂O₃

InChI: InChI=1S/C17H23BN2O3/c1-16(2)17(3,4)23-18(22-16)14-12-19-20(13-14)10-11-21-15-8-6-5-7-9-15/h5-9,12-13H,10-11H2,1-4H3

InChI key: InChIKey=GCDFMMCXCDMFMR-UHFFFAOYSA-N

SMILES: CC1(C)OB(OC1(C)C)C2=CN(CCOC3=CC=CC=C3)N=C2

Synonyms:

• 1-(2-Phenoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
• 1H-Pyrazole, 1-(2-phenoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-