CAS 120570-12-9

Benzenesulfinic acid, 2,5-dimethyl-, sodium salt (1:1)

Description:

Benzenesulfinic acid, 2,5-dimethyl-, sodium salt (1:1) is an organosulfur compound characterized by the presence of a sulfinic acid functional group attached to a benzene ring that is further substituted with two methyl groups at the 2 and 5 positions. This compound typically appears as a white to off-white solid and is soluble in water due to the ionic nature of the sodium salt. Its chemical structure contributes to its reactivity, making it useful in various applications, including as a reducing agent in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. The presence of the sulfinic acid group imparts unique properties, such as the ability to participate in nucleophilic substitution reactions. Additionally, the compound's stability and solubility profile make it suitable for use in aqueous environments. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₈H₁₀O₂S·Na

InChI: InChI=1S/C8H10O2S.Na/c1-6-3-4-7(2)8(5-6)11(9)10;/h3-5H,1-2H3,(H,9,10);

InChI key: InChIKey=FBPOWRJSTMFROK-UHFFFAOYSA-N

SMILES: S(=O)(O)C1=C(C)C=CC(C)=C1.[Na]

Synonyms:

• Benzenesulfinic acid, 2,5-dimethyl-, sodium salt (1:1)
• Sodium 2,5-dimethylbenzenesulfinate
• Benzenesulfinic acid, 2,5-dimethyl-, sodium salt