CAS 1205748-66-8

4-Piperidinecarbonitrile, 4-ethyl-, hydrochloride (1:1)

Description:

4-Piperidinecarbonitrile, 4-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a cyano group (-C≡N) at the 4-position of the piperidine ring contributes to its reactivity and potential applications in organic synthesis. The ethyl group at the same position enhances its lipophilicity, which can influence its biological activity and solubility properties. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it easier to handle in laboratory settings. This compound may exhibit pharmacological properties, and its derivatives are often explored in medicinal chemistry for potential therapeutic applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₈H₁₄N₂·ClH

InChI: InChI=1S/C8H14N2.ClH/c1-2-8(7-9)3-5-10-6-4-8;/h10H,2-6H2,1H3;1H

InChI key: InChIKey=ZOCUAHPTSGPJKY-UHFFFAOYSA-N

SMILES: C(C)C1(C#N)CCNCC1.Cl

Synonyms:

• 4-Piperidinecarbonitrile, 4-ethyl-, hydrochloride (1:1)

4-ethyl-4-piperidinecarbonitrile hydrochloride

CAS: 1205748-66-8

Formula: C₈H₁₅ClN₂

Purity: 95.0%

Molecular weight: 174.67

Ref: 10-F360703