CAS 1205750-24-8

3-Piperidinecarbonitrile, 3-ethyl-, hydrochloride (1:1)

Description:

3-Piperidinecarbonitrile, 3-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of a carbonitrile group indicates that it has a cyano functional group (-C≡N) attached to the piperidine, contributing to its reactivity and potential applications in organic synthesis. The "3-ethyl" designation specifies that an ethyl group is attached to the third carbon of the piperidine ring, influencing the compound's steric and electronic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in various chemical reactions and biological applications. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which can interact with biological targets. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.

Formula: C₈H₁₄N₂·ClH

InChI: InChI=1S/C8H14N2.ClH/c1-2-8(6-9)4-3-5-10-7-8;/h10H,2-5,7H2,1H3;1H

InChI key: InChIKey=ZZUYFOHDDVFGRI-UHFFFAOYSA-N

SMILES: C(C)C1(C#N)CCCNC1.Cl

Synonyms:

• 3-Piperidinecarbonitrile, 3-ethyl-, hydrochloride (1:1)

3-ethyl-3-piperidinecarbonitrile hydrochloride

CAS: 1205750-24-8

Formula: C₈H₁₅ClN₂

Purity: 95.0%

Molecular weight: 174.67

Ref: 10-F360691