CAS 120576-71-8
:1,4-dideoxy-1,4-iminoallitol
Description:
1,4-Dideoxy-1,4-iminoallitol is a chemical compound that belongs to the class of iminosugars, which are characterized by the presence of an imino group (C=N) in place of a hydroxyl group. This compound is notable for its structural similarity to monosaccharides, particularly in its ability to mimic the structure of glucose. It is often studied for its potential biological activities, including its role as an inhibitor of glycosidases, enzymes that play a crucial role in carbohydrate metabolism. The inhibition of these enzymes can have implications in the treatment of various conditions, including diabetes and viral infections. Additionally, 1,4-dideoxy-1,4-iminoallitol may exhibit properties that influence cell signaling and metabolic pathways. Its unique structure allows it to interact with biological systems in ways that can modulate physiological responses. As with many iminosugars, research into its pharmacological properties and potential therapeutic applications is ongoing, highlighting its significance in medicinal chemistry and biochemistry.
Formula:C6H13NO4
InChI:InChI=1/C6H13NO4/c8-2-4(10)5-6(11)3(9)1-7-5/h3-11H,1-2H2/t3-,4?,5+,6-/m1/s1
Synonyms:- 1,4-Dideoxy-1,4-imino-L-allitol
- 1,4-Dia
- (2S,3S,4R)-2-(1,2-dihydroxyethyl)pyrrolidine-3,4-diol
- 1,4-Dideoxy-1,4-iminoallitol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(2S, 3S, 4R) -2- [(1R) - 1, 2-Dihydroxyethyl] -3, 4- pyrrolidinediol
CAS:<p>(2S, 3S, 4R) -2- [(1R) - 1, 2-Dihydroxyethyl] -3, 4- pyrrolidinediol is a benzyl-containing compound that is used as a glycoside hydrolase inhibitor. It has been shown to be an effective treatment for inflammatory bowel disease. This drug binds to the active site of glycosidases and blocks the hydrolysis of c-glycosides in the intestine. (2S, 3S, 4R) -2- [(1R) - 1, 2-Dihydroxyethyl] -3, 4- pyrrolidinediol also inhibits chloride channels and has been shown to have antiinflammatory properties.</p>Formula:C6H13NO4Purity:Min. 95%Molecular weight:163.17 g/mol
