CAS 120577-33-5

(3R)-N-[(1S)-1-phenylethyl]-1-azabicyclo[2.2.2]octan-3-amine

Description:

The chemical substance known as (3R)-N-[(1S)-1-phenylethyl]-1-azabicyclo[2.2.2]octan-3-amine, with the CAS number 120577-33-5, is a bicyclic amine that features a unique bicyclo[2.2.2]octane framework. This compound is characterized by its chiral centers, which contribute to its stereochemistry and potential biological activity. The presence of the phenylethyl group suggests that it may interact with biological systems, possibly influencing neurotransmitter pathways or receptor interactions. Its azabicyclic structure indicates that it may exhibit properties typical of both cyclic and acyclic amines, such as basicity and potential for hydrogen bonding. The compound's stereochemistry, particularly the (3R) and (1S) configurations, may play a crucial role in its pharmacological profile, affecting how it binds to targets in biological systems. Overall, this substance may have implications in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas.

Formula: C₁₅H₂₂N₂

InChI: InChI=1/C15H22N2/c1-12(13-5-3-2-4-6-13)16-15-11-17-9-7-14(15)8-10-17/h2-6,12,14-16H,7-11H2,1H3/t12-,15-/m0/s1

SMILES: C[C@@H](c1ccccc1)N[C@H]1CN2CCC1CC2

Synonyms:

• (3R)-N-[(1S)-1-Phenylethyl]-1-azabicyclo[2.2.2]octan-3-amin
• (3R)-N-[(1S)-1-phenylethyl]quinuclidin-3-amine