CAS 120593-19-3
:15-fluoro-13,14-dehydrocarbacyclin
Description:
15-Fluoro-13,14-dehydrocarbacyclin is a synthetic organic compound characterized by its unique structural features, including a fluorine atom substitution and a dehydrocyclopentane framework. This compound belongs to a class of molecules known for their potential biological activity, particularly in the field of medicinal chemistry. The presence of the fluorine atom can enhance the lipophilicity and metabolic stability of the compound, which may influence its pharmacokinetic properties. The dehydrocarbacyclin structure suggests that it may exhibit interesting conformational characteristics, potentially affecting its interaction with biological targets. As with many synthetic compounds, its reactivity and stability can be influenced by environmental factors such as pH and temperature. Research into this compound may focus on its synthesis, characterization, and potential applications in drug development or as a biochemical probe. However, specific biological activities, toxicity, and therapeutic potential would require further investigation through experimental studies.
Formula:C21H31FO3
InChI:InChI=1/C21H31FO3/c1-2-3-4-8-17(22)10-11-18-19-13-15(7-5-6-9-21(24)25)12-16(19)14-20(18)23/h7,16-20,23H,2-6,8-9,12-14H2,1H3,(H,24,25)/b15-7-/t16-,17+,18+,19-,20+/m1/s1
Synonyms:- 15-Fdcc
- 15-Fluoro-13,14-dehydrocarbacycline
- 15-Fluoro-13,14-didehydrocarbacyclin
- Pentanoic acid, 5-(4-(3-fluoro-1-octynyl)hexahydro-5-hydroxy-2(1H)-pentalenylidene)-, (2Z,3aalpha,4alpha(S*),5beta,6aalpha)-(+-)-
- (5Z)-5-[(3aR,4R,5S,6aR)-4-[(3S)-3-fluorooct-1-yn-1-yl]-5-hydroxyhexahydropentalen-2(1H)-ylidene]pentanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.