CAS 120595-80-4: P-acetamidophenyl B-D-glucuronide*sodium
Description:P-acetamidophenyl B-D-glucuronide sodium, with the CAS number 120595-80-4, is a chemical compound that serves as a glucuronide conjugate of p-acetamidophenol (commonly known as acetaminophen). This compound is characterized by its structure, which includes a phenolic moiety linked to a glucuronic acid unit, facilitating its solubility and excretion in biological systems. The sodium salt form enhances its stability and solubility in aqueous solutions, making it suitable for various biochemical applications. It is often studied in the context of drug metabolism, as glucuronidation is a key phase II metabolic pathway that aids in detoxifying and eliminating drugs and xenobiotics from the body. The compound may exhibit low toxicity and is generally considered safe for use in research settings. Its properties, such as solubility, stability, and reactivity, make it a valuable tool in pharmacological studies, particularly in understanding the metabolism of acetaminophen and related compounds.
Formula:C14H16NNaO8
InChI:InChI=1/C14H17NO8.Na/c1-6(16)15-7-2-4-8(5-3-7)22-14-11(19)9(17)10(18)12(23-14)13(20)21;/h2-5,9-12,14,17-19H,1H3,(H,15,16)(H,20,21);/q;+1/p-1/t9-,10-,11+,12-,14-;/m1./s1
- Synonyms:
- p-Acetamidophenyl beta-D-glucuronide
- sodium (2R,3R,4R,5S,6S)-6-(4-acetamidophenoxy)-3,4,5-trihydroxy-tetrahydropyran-2-carboxylate
