
CAS 1206-38-8
:2-(4-Chlorophenyl)-2-methyl-1,3-dioxolane-4-methanol
Description:
2-(4-Chlorophenyl)-2-methyl-1,3-dioxolane-4-methanol, with the CAS number 1206-38-8, is an organic compound characterized by its unique structural features, including a dioxolane ring and a chlorophenyl group. This compound typically exhibits a moderate polarity due to the presence of both hydrophobic aromatic and hydrophilic hydroxyl functional groups. The chlorophenyl moiety contributes to its potential biological activity, as halogenated aromatic compounds often exhibit interesting pharmacological properties. The dioxolane ring structure can influence the compound's reactivity and stability, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the hydroxymethyl group may enhance solubility in polar solvents and facilitate interactions with biological targets. Overall, this compound's characteristics suggest potential applications in medicinal chemistry and materials science, although specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C11H13ClO3
InChI:InChI=1S/C11H13ClO3/c1-11(14-7-10(6-13)15-11)8-2-4-9(12)5-3-8/h2-5,10,13H,6-7H2,1H3
InChI key:InChIKey=IPYOCBWUDXJNGI-UHFFFAOYSA-N
SMILES:CC1(C2=CC=C(Cl)C=C2)OC(CO)CO1
Synonyms:- K 161
- 1,3-Dioxolane-4-methanol, 2-(4-chlorophenyl)-2-methyl-
- 2-Methyl-2-p-chlorophenyl-4-hydroxymethyl-1,3-dioxolane
- 1,3-Dioxolane-4-methanol, 2-(p-chlorophenyl)-2-methyl-
- 2-(4-Chlorophenyl)-2-methyl-1,3-dioxolane-4-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.