CAS 1206-79-7

2,3,4,5,6,7,8,9-Octahydro-1H-trindene

Description:

2,3,4,5,6,7,8,9-Octahydro-1H-trindene, with the CAS number 1206-79-7, is a bicyclic hydrocarbon that belongs to the class of polycyclic aromatic hydrocarbons. This compound is characterized by its complex structure, which consists of multiple fused cycloalkane rings. It is typically a colorless to pale yellow liquid at room temperature and exhibits a relatively low volatility. The compound is known for its stability and resistance to oxidation, making it useful in various chemical applications. Its hydrophobic nature limits its solubility in water, but it is soluble in organic solvents. Due to its unique structure, 2,3,4,5,6,7,8,9-Octahydro-1H-trindene may exhibit interesting chemical reactivity, particularly in reactions involving electrophiles or nucleophiles. Additionally, it may have applications in materials science and organic synthesis, although specific uses can vary based on its properties and reactivity. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₅H₁₈

InChI: InChI=1/C15H18/c1-4-10-11(5-1)13-7-3-9-15(13)14-8-2-6-12(10)14/h1-9H2

SMILES: C1Cc2c(C1)c1CCCc1c1CCCc21

Synonyms:

• Trindane
• 2,3,4,5,6,7,8,9-octahydro-1H-cyclopenta[e]-as-indacene