CAS 1206-91-3
:3-Amino-2,4,6-triiodobenzenepropanoic acid
Description:
3-Amino-2,4,6-triiodobenzenepropanoic acid, with the CAS number 1206-91-3, is an organic compound characterized by its aromatic structure and the presence of multiple iodine substituents. This compound features a benzene ring with three iodine atoms attached at the 2, 4, and 6 positions, along with an amino group (-NH2) and a propanoic acid moiety. The presence of iodine atoms significantly influences its chemical properties, including increased molecular weight and potential for enhanced reactivity due to the electronegative nature of iodine. The amino group contributes to its basicity and potential for forming hydrogen bonds, while the carboxylic acid group (-COOH) imparts acidic characteristics. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a precursor for synthesizing other complex molecules. Its solubility and stability in different solvents can vary, influenced by the functional groups present and the overall molecular structure.
Formula:C9H8I3NO2
InChI:InChI=1/C9H8I3NO2/c10-5-3-6(11)9(13)8(12)4(5)1-2-7(14)15/h3H,1-2,13H2,(H,14,15)
InChI key:InChIKey=BVDHMFVGWNGIQE-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C1=C(I)C(N)=C(I)C=C1I
Synonyms:- 3-(3-Amino-2,4,6-Triiodophenyl)Propanoic Acid
- 3-Amino-2,4,6-Triiodo-Benzenepropanoic Aci
- 3-Amino-2,4,6-Triiodo-Hydrocinnamic Aci
- 3-Amino-2,4,6-Triiodohydrocinnamic Acid
- 3-Amino-2,4,6-triiodobenzenepropanoic acid
- Benzenepropanoic acid, 3-amino-2,4,6-triiodo-
- Beta-(2,4,6-Trijod-3-Aminophenyl)-Propionsaeure
- Hydrocinnamic acid, 3-amino-2,4,6-triiodo-
- Iodobilimin acid
- Win 4837
- β-(3-Amino-2,4,6-triiodophenyl)propionic acid
- 3-(3-azanyl-2,4,6-triiodo-phenyl)propanoic acid
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.