CAS 1206077-95-3

2-Chloroethyl N-[4-(acetylamino)-3-methoxyphenyl]carbamate

Description:

2-Chloroethyl N-[4-(acetylamino)-3-methoxyphenyl]carbamate is a chemical compound characterized by its specific functional groups and structural features. It contains a chloroethyl moiety, which contributes to its reactivity, and a carbamate group that is known for its role in biological activity and potential pharmacological applications. The presence of an acetylamino group and a methoxyphenyl group suggests that this compound may exhibit unique interactions with biological targets, potentially influencing its solubility, stability, and overall efficacy. The molecular structure indicates that it may participate in hydrogen bonding and other intermolecular interactions, which can affect its behavior in various environments. Additionally, the compound's characteristics, such as its melting point, boiling point, and solubility, would depend on its molecular weight and the nature of its substituents. Overall, 2-Chloroethyl N-[4-(acetylamino)-3-methoxyphenyl]carbamate represents a complex organic molecule with potential applications in medicinal chemistry and related fields.

Formula: C₁₂H₁₅ClN₂O₄

InChI: InChI=1S/C12H15ClN2O4/c1-8(16)14-10-4-3-9(7-11(10)18-2)15-12(17)19-6-5-13/h3-4,7H,5-6H2,1-2H3,(H,14,16)(H,15,17)

InChI key: InChIKey=OSGRNIJBPSDPKQ-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1=C(OC)C=C(NC(OCCCl)=O)C=C1

Synonyms:

• Carbamic acid, N-[4-(acetylamino)-3-methoxyphenyl]-, 2-chloroethyl ester
• 2-Chloroethyl N-[4-(acetylamino)-3-methoxyphenyl]carbamate