CAS 120613-46-9
:tetrazolo[1,5-a]pyridine-7-carboxylic acid
Description:
Tetrazolo[1,5-a]pyridine-7-carboxylic acid is a heterocyclic compound characterized by a fused tetrazole and pyridine ring system. This compound features a carboxylic acid functional group at the 7-position of the pyridine ring, which contributes to its acidic properties. The presence of the tetrazole ring imparts unique chemical reactivity and potential biological activity, making it of interest in medicinal chemistry and drug development. The compound is typically crystalline and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its structure allows for various functionalization possibilities, which can enhance its pharmacological properties. Tetrazolo[1,5-a]pyridine derivatives have been studied for their potential applications in areas such as anti-inflammatory, antimicrobial, and anticancer therapies. The compound's stability, reactivity, and interaction with biological targets are influenced by its electronic structure and the presence of heteroatoms in the rings. Overall, tetrazolo[1,5-a]pyridine-7-carboxylic acid represents a versatile scaffold in organic synthesis and pharmaceutical research.
Formula:C6H4N4O2
InChI:InChI=1/C6H4N4O2/c11-6(12)4-1-2-10-5(3-4)7-8-9-10/h1-3H,(H,11,12)
SMILES:c1cn2c(cc1C(=O)O)nnn2
Synonyms:- tetrazolo[1,5-a]pyridine-7-carboxylic acid
- tetrazolo[1,5-a]pyridine-7-carboxylic acid(SALTDATA: FREE)
- 1,2,3,4]tetrazolo[1,5-a]pyridine-7-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
