CymitQuimica logo

CAS 12062-13-4

:

Niobate(1-), hexafluoro-, ammonium (1:1), (OC-6-11)-

Description:
Niobate(1-), hexafluoro-, ammonium (1:1), (OC-6-11)-, with the CAS number 12062-13-4, is a chemical compound that features niobium in a negative oxidation state, specifically as a niobate ion. This compound is characterized by the presence of hexafluoro groups, which contribute to its unique chemical properties, including high stability and potential reactivity in various chemical environments. The ammonium component indicates that it can form ionic bonds, enhancing its solubility in polar solvents. The notation (OC-6-11) suggests that the compound may have a specific organic chain or substituent, which can influence its physical properties, such as hydrophobicity or interaction with other molecules. Overall, this compound is of interest in materials science and chemistry due to its potential applications in electronics, catalysis, and as a precursor in the synthesis of other niobium-containing materials. Its unique structural characteristics make it a subject of study for researchers exploring advanced materials and chemical reactivity.
Formula:F6Nb·H4N
InChI:InChI=1S/6FH.H3N.Nb/h6*1H;1H3;/q;;;;;;;+5/p-5
InChI key:InChIKey=SKIHFCFFRXCIJA-UHFFFAOYSA-I
SMILES:[Nb+5]([F-])([F-])([F-])([F-])([F-])[F-].[NH4+]
Synonyms:
  • Niobate(1-), hexafluoro-, ammonium (1:1), (OC-6-11)-
  • Niobate(1-), hexafluoro-, ammonium, (OC-6-11)-
  • Niobate(1-), hexafluoro-, ammonium
  • Ammonium fluoniobate(V)
  • Ammonium hexafluoroniobate(V)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.