
CAS 1206200-21-6
:Pyrrolo[1,2-a]quinoxaline-8-carbonitrile
Description:
Pyrrolo[1,2-a]quinoxaline-8-carbonitrile is a heterocyclic organic compound characterized by its fused pyrrole and quinoxaline rings, along with a cyano group at the 8-position. This compound typically exhibits a planar structure, which contributes to its potential for π-π stacking interactions, making it of interest in various applications, including organic electronics and pharmaceuticals. The presence of the cyano group enhances its reactivity and solubility in polar solvents, while also influencing its electronic properties. Pyrrolo[1,2-a]quinoxaline derivatives are often studied for their biological activities, including potential anticancer and antimicrobial properties. The compound's synthesis usually involves multi-step organic reactions, and it can be characterized using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography. Its unique structural features and functional groups make it a valuable target for research in medicinal chemistry and materials science.
Formula:C12H7N3
InChI:InChI=1S/C12H7N3/c13-7-9-3-4-11-12(6-9)15-5-1-2-10(15)8-14-11/h1-6,8H
InChI key:InChIKey=LCTIRYIEGSGQSL-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C2N3C(C=NC2=CC1)=CC=C3
Synonyms:- Pyrrolo[1,2-a]quinoxaline-8-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
