
CAS 1206207-43-3
:5-Iodo-2-(methylthio)imidazo[2,1-b]-1,3,4-thiadiazole
Description:
5-Iodo-2-(methylthio)imidazo[2,1-b]-1,3,4-thiadiazole is a heterocyclic compound characterized by the presence of both imidazole and thiadiazole rings, which contribute to its unique chemical properties. The presence of an iodine atom enhances its reactivity, particularly in nucleophilic substitution reactions. The methylthio group introduces a sulfur atom, which can participate in various chemical interactions, including potential coordination with metal ions. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic structure, which may influence its solubility in organic solvents. Additionally, the presence of multiple heteroatoms (nitrogen and sulfur) suggests potential biological activity, making it of interest in medicinal chemistry and drug development. Its structural features may also confer specific electronic properties, affecting its behavior in chemical reactions and interactions with biological targets. Overall, 5-Iodo-2-(methylthio)imidazo[2,1-b]-1,3,4-thiadiazole is a complex molecule with potential applications in pharmaceuticals and materials science.
Formula:C5H4IN3S2
InChI:InChI=1S/C5H4IN3S2/c1-10-5-8-9-3(6)2-7-4(9)11-5/h2H,1H3
InChI key:InChIKey=XRTLKGYFPNRMPI-UHFFFAOYSA-N
SMILES:IC=1N2C(SC(SC)=N2)=NC1
Synonyms:- 5-Iodo-2-(methylthio)imidazo[2,1-b]-1,3,4-thiadiazole
- Imidazo[2,1-b]-1,3,4-thiadiazole, 5-iodo-2-(methylthio)-
- 5-Iodo-2-methylsulfanylimidazo[2,1-b]-[1,3,4]thiadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.