CymitQuimica logo

CAS 1206229-02-8

:

3-Ethyl-3-piperidinecarbonitrile

Description:
3-Ethyl-3-piperidinecarbonitrile is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the ethyl group at the 3-position of the piperidine ring contributes to its unique properties, including its potential solubility in organic solvents. The carbonitrile functional group (-C≡N) attached to the same carbon as the ethyl group imparts significant reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. This compound may exhibit polar characteristics due to the electronegative nitrogen in the carbonitrile group, influencing its interactions with other molecules. Additionally, its structure suggests potential biological activity, which could be explored in pharmacological contexts. As with many nitrogen-containing compounds, it may also participate in hydrogen bonding, affecting its physical properties such as boiling and melting points. Overall, 3-Ethyl-3-piperidinecarbonitrile is a versatile compound with applications in research and industry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C8H14N2
InChI:InChI=1S/C8H14N2/c1-2-8(6-9)4-3-5-10-7-8/h10H,2-5,7H2,1H3
InChI key:InChIKey=NSIVBFUOXLJYCT-UHFFFAOYSA-N
SMILES:C(C)C1(C#N)CCCNC1
Synonyms:
  • 3-Ethyl-3-piperidinecarbonitrile
  • 3-Piperidinecarbonitrile, 3-ethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.