CymitQuimica logo

CAS 1206248-43-2

:

6-Chloro-2,4-pyridinediamine

Description:
6-Chloro-2,4-pyridinediamine, identified by its CAS number 1206248-43-2, is an organic compound characterized by the presence of a pyridine ring substituted with two amino groups and a chlorine atom. This compound typically exhibits properties associated with aromatic amines, including potential solubility in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. The chlorine substituent at the 6-position of the pyridine ring can influence the compound's reactivity and stability, potentially making it a useful intermediate in organic synthesis or pharmaceutical applications. The presence of multiple functional groups suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the compound's structure may confer specific biological activities, making it of interest in medicinal chemistry. Safety and handling considerations are essential, as many chlorinated amines can pose health risks, necessitating appropriate precautions during use and disposal.
Formula:C5H6ClN3
InChI:InChI=1S/C5H6ClN3/c6-4-1-3(7)2-5(8)9-4/h1-2H,(H4,7,8,9)
InChI key:InChIKey=GNSABFRTUHJSLD-UHFFFAOYSA-N
SMILES:NC=1C=C(Cl)N=C(N)C1
Synonyms:
  • 2,4-Pyridinediamine, 6-chloro-
  • 6-Chloro-2,4-pyridinediamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.