CAS 1206248-78-3

Methyl 7-chloroimidazo[1,2-a]pyridine-3-carboxylate

Description:

Methyl 7-chloroimidazo[1,2-a]pyridine-3-carboxylate is a chemical compound characterized by its imidazo-pyridine structure, which incorporates a chlorine atom at the 7-position and a carboxylate ester functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural features. The presence of the chlorine atom can influence its reactivity and solubility, while the methyl ester group may enhance its lipophilicity, affecting its pharmacokinetic properties. Methyl 7-chloroimidazo[1,2-a]pyridine-3-carboxylate may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with imidazo-pyridine frameworks are often explored for their potential therapeutic effects. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, this compound represents a specific class of heterocycles that may have applications in various fields, including drug discovery and development.

Formula: C₉H₇ClN₂O₂

InChI: InChI=1S/C9H7ClN2O2/c1-14-9(13)7-5-11-8-4-6(10)2-3-12(7)8/h2-5H,1H3

InChI key: InChIKey=BRGBCEIVDGSQRX-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1N2C(=NC1)C=C(Cl)C=C2

Synonyms:

• Methyl 7-chloroimidazo[1,2-a]pyridine-3-carboxylate
• Imidazo[1,2-a]pyridine-3-carboxylic acid, 7-chloro-, methyl ester