CAS 1206250-52-3

6-(Trifluoromethyl)thiazolo[4,5-b]pyridin-2-amine

Description:

6-(Trifluoromethyl)thiazolo[4,5-b]pyridin-2-amine is a heterocyclic compound characterized by the presence of both thiazole and pyridine rings, which contribute to its unique chemical properties. The trifluoromethyl group (-CF3) attached to the thiazole ring enhances the compound's lipophilicity and can influence its biological activity. This compound typically exhibits a range of polar and non-polar characteristics due to the presence of nitrogen and sulfur atoms in its structure. It may also demonstrate interesting reactivity patterns, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the amino group (-NH2) suggests potential for hydrogen bonding, which can affect solubility and interaction with biological targets. Overall, this compound's structural features make it of interest in medicinal chemistry and materials science, particularly in the development of pharmaceuticals or agrochemicals. Its specific properties, such as melting point, solubility, and reactivity, would need to be determined experimentally or sourced from chemical databases for precise applications.

Formula: C₇H₄F₃N₃S

InChI: InChI=1S/C7H4F3N3S/c8-7(9,10)3-1-4-5(12-2-3)13-6(11)14-4/h1-2H,(H2,11,12,13)

InChI key: InChIKey=QSALCPGVJCPHOJ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C2C(=NC1)N=C(N)S2

Synonyms:

• Thiazolo[4,5-b]pyridin-2-amine, 6-(trifluoromethyl)-
• 6-(Trifluoromethyl)thiazolo[4,5-b]pyridin-2-amine

6-(Trifluoromethyl)-[1,3]thiazolo[4,5-b]pyridin-2-amine

CAS: 1206250-52-3

Versatile small molecule scaffold

Formula: C₇H₄F₃N₃S

Purity: Min. 95%

Molecular weight: 219.19 g/mol

Ref: 3D-GYB25052