CAS 1206250-53-4

4-bromo-2-chloro-6-methylpyridine

Description:

4-Bromo-2-chloro-6-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a bromine atom at the 4-position, a chlorine atom at the 2-position, and a methyl group at the 6-position. This compound is part of the pyridine family, which is known for its aromatic properties and basicity due to the nitrogen atom in the ring. The presence of halogen substituents (bromine and chlorine) can influence its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The methyl group contributes to the compound's hydrophobic character and can affect its solubility in organic solvents. 4-Bromo-2-chloro-6-methylpyridine may also exhibit biological activity, making it of interest in pharmaceutical research. Its physical properties, such as boiling point, melting point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, this compound serves as a valuable intermediate in organic synthesis and medicinal chemistry.

Formula: C₆H₅BrClN

InChI: InChI=1S/C6H5BrClN/c1-4-2-5(7)3-6(8)9-4/h2-3H,1H3

InChI key: InChIKey=VZKVJDPXLSTENW-UHFFFAOYSA-N

SMILES: Cc1cc(cc(Cl)n1)Br

Synonyms:

• Pyridine, 4-bromo-2-chloro-6-methyl-

4-Bromo-2-chloro-6-methylpyridine

CAS: 1206250-53-4

Formula: C₆H₅BrClN

Purity: 98%

Color and Shape: Liquid

Molecular weight: 206.4676

Ref: IN-DA00922H

4-Bromo-2-chloro-6-methylpyridine

CAS: 1206250-53-4

4-Bromo-2-chloro-6-methylpyridine

Purity: 97%

Molecular weight: 206.47g/mol

Ref: 54-OR94505

4-Bromo-2-chloro-6-methylpyridine

CAS: 1206250-53-4

Formula: C₆H₅BrClN

Purity: 97%

Color and Shape: Liquid

Molecular weight: 206.47

Ref: 10-F210619