CAS 120635-25-8
:Mofegiline hydrochloride
Description:
Mofegiline hydrochloride is a chemical compound primarily recognized for its role as a selective monoamine oxidase B (MAO-B) inhibitor, which is significant in the treatment of neurodegenerative disorders, particularly Parkinson's disease. As a hydrochloride salt, it enhances the solubility and stability of the active compound. Mofegiline exhibits a unique mechanism of action by selectively inhibiting the breakdown of dopamine, thereby increasing its availability in the brain, which is crucial for motor control and cognitive function. The compound is characterized by its specific molecular structure, which includes a chiral center, contributing to its pharmacological activity. In terms of physical properties, Mofegiline hydrochloride is typically a white to off-white crystalline powder, soluble in water and various organic solvents. Its pharmacokinetics involve oral administration, with metabolism primarily occurring in the liver. Safety and efficacy profiles are established through clinical studies, and like other MAO inhibitors, it requires careful dietary considerations to avoid hypertensive crises. Overall, Mofegiline hydrochloride represents a valuable therapeutic option in managing conditions associated with dopamine deficiency.
Formula:C11H14ClF2N
InChI:InChI=1/C11H13F2N.ClH/c12-7-10(8-14)2-1-9-3-5-11(13)6-4-9;/h3-7H,1-2,8,14H2;1H/b10-7+;
Synonyms:- Mofegiline HCl
- Mofegiline
- (2Z)-2-(fluoromethylene)-4-(4-fluorophenyl)butan-1-amine hydrochloride
- (2E)-2-(fluoromethylidene)-4-(4-fluorophenyl)butan-1-amine hydrochloride
- (E)-3-Fluoro-2-[2-(4-fluoro-phenyl)-ethyl]-allylamine hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Mofegiline hydrochloride
CAS:Mofegiline hydrochloride is a potent and selective enzyme-activated irreversible MAO-B inhibitor.Formula:C11H14ClF2NPurity:98%Color and Shape:SolidMolecular weight:233.69
