CAS 120650-77-3
:Methyl-10,12-pentacosadiynoate
Description:
Methyl-10,12-pentacosadiynoate is a chemical compound characterized by its unique structure, which includes a long carbon chain and two conjugated triple bonds. This compound belongs to the class of diacetylenes, which are known for their interesting optical and electronic properties. Methyl-10,12-pentacosadiynoate is typically a colorless to pale yellow liquid, exhibiting low solubility in water but good solubility in organic solvents. Its molecular structure allows for potential applications in materials science, particularly in the development of conductive polymers and photonic devices. The presence of multiple triple bonds contributes to its reactivity, making it a candidate for polymerization reactions, which can lead to the formation of stable, high-performance materials. Additionally, the compound may exhibit interesting thermal and mechanical properties, making it valuable in various industrial applications. Safety data should be consulted for handling and storage, as compounds with similar structures can pose health risks.
Formula:C26H44O2
InChI:InChI=1/C26H44O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27)28-2/h3-13,18-25H2,1-2H3
SMILES:CCCCCCCCCCCCC#CC#CCCCCCCCCC(=O)OC
Synonyms:- 10,12-Pentacosadiynoic acid methyl ester
- Methyl Pentacosa-10,12-Diynoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
10,12-Pentacosadiynoic Acid Methyl Ester
CAS:Controlled ProductFormula:C26H44O2Color and Shape:NeatMolecular weight:388.6310,12-Pentacosadiynoic Acid Methyl-d3 Ester
CAS:Controlled ProductFormula:C26H41D3O2Color and Shape:NeatMolecular weight:453.403


