CAS 120650-90-0

2-Butenamide, 2-cyano-3-(dimethylamino)-, (E)-

Description:

2-Butenamide, 2-cyano-3-(dimethylamino)-, (E)- is an organic compound characterized by its amide functional group and a cyano group attached to a butenamide backbone. This compound features a double bond in the butenamide structure, specifically in the E configuration, indicating the relative positioning of substituents around the double bond. The presence of the dimethylamino group contributes to its basicity and potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The cyano group enhances the compound's polarity and can influence its solubility in polar solvents. This compound may be of interest in synthetic organic chemistry and medicinal chemistry due to its structural features, which could impart specific biological activities or serve as intermediates in the synthesis of more complex molecules. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards.

Formula: C₇H₁₁N₃O

InChI: InChI=1S/C7H11N3O/c1-5(10(2)3)6(4-8)7(9)11/h1-3H3,(H2,9,11)/b6-5+

InChI key: InChIKey=CPNKUDCDGKOECR-AATRIKPKSA-N

SMILES: C(=C(/N(C)C)\C)(\C(N)=O)/C#N

Synonyms:

• 2-Butenamide, 2-cyano-3-(dimethylamino)-, (E)-