CAS 1206523-77-4

2-Bromo-5-[(trifluoromethyl)sulfinyl]pyrazine

Description:

2-Bromo-5-[(trifluoromethyl)sulfinyl]pyrazine is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The compound features a bromine atom at the 2-position and a sulfinyl group with a trifluoromethyl substituent at the 5-position, contributing to its unique chemical properties. The trifluoromethyl group is known for its electron-withdrawing effects, which can enhance the compound's reactivity in various chemical reactions. The sulfinyl group introduces potential for further functionalization, making it a valuable intermediate in synthetic organic chemistry. This compound may exhibit interesting biological activities due to its structural features, and its bromine and trifluoromethyl groups can influence its solubility and stability. As with many halogenated compounds, it is essential to handle 2-Bromo-5-[(trifluoromethyl)sulfinyl]pyrazine with care, considering potential toxicity and environmental impact. Its applications may span across pharmaceuticals, agrochemicals, and materials science, depending on ongoing research and development.

Formula: C₅H₂BrF₃N₂OS

InChI: InChI=1S/C5H2BrF3N2OS/c6-3-1-11-4(2-10-3)13(12)5(7,8)9/h1-2H

InChI key: InChIKey=QUKJHZXIOXMTON-UHFFFAOYSA-N

SMILES: S(C(F)(F)F)(=O)C=1C=NC(Br)=CN1

Synonyms:

• 2-Bromo-5-[(trifluoromethyl)sulfinyl]pyrazine
• Pyrazine, 2-bromo-5-[(trifluoromethyl)sulfinyl]-