CAS 1206523-91-2

1,1-Dimethylethyl 3-(trifluoromethoxy)-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl 3-(trifluoromethoxy)-1-pyrrolidinecarboxylate, identified by its CAS number 1206523-91-2, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a trifluoromethoxy group. This compound typically exhibits properties associated with both polar and nonpolar characteristics due to the presence of fluorinated groups, which can enhance its lipophilicity and stability. The trifluoromethoxy group contributes to its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The dimethyl substituents on the pyrrolidine ring can influence its steric hindrance and electronic properties, affecting its interaction with biological targets. Additionally, this compound may exhibit interesting solubility characteristics, making it suitable for various organic synthesis applications. Overall, its unique functional groups and structural features suggest potential utility in chemical research and development, particularly in the fields of agrochemicals and drug design.

Formula: C₁₀H₁₆F₃NO₃

InChI: InChI=1S/C10H16F3NO3/c1-9(2,3)17-8(15)14-5-4-7(6-14)16-10(11,12)13/h7H,4-6H2,1-3H3

InChI key: InChIKey=WVMFTUHMEJKBAC-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1CN(C(OC(C)(C)C)=O)CC1

Synonyms:

• 1-Pyrrolidinecarboxylic acid, 3-(trifluoromethoxy)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-(trifluoromethoxy)-1-pyrrolidinecarboxylate