CAS 1206524-33-5
:3-Iodo-6-(trifluoromethyl)pyridazine
Description:
3-Iodo-6-(trifluoromethyl)pyridazine is a heterocyclic organic compound characterized by the presence of a pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The compound features an iodine atom at the 3-position and a trifluoromethyl group (-CF3) at the 6-position of the pyridazine ring, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and biological activity. This compound is typically used in various fields, including medicinal chemistry and agrochemicals, due to its potential as a building block for more complex molecules. Its iodine substituent may also impart specific reactivity patterns, making it useful in nucleophilic substitution reactions. Additionally, the trifluoromethyl group can stabilize the compound and affect its electronic properties, making it an interesting subject for research in synthetic chemistry and material science. Overall, 3-Iodo-6-(trifluoromethyl)pyridazine exhibits distinctive characteristics that make it valuable in chemical synthesis and applications.
Formula:C5H2F3IN2
InChI:InChI=1S/C5H2F3IN2/c6-5(7,8)3-1-2-4(9)11-10-3/h1-2H
InChI key:InChIKey=ZMGDYHBXBQSOJT-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC=C(I)N=N1
Synonyms:- 3-Iodo-6-(trifluoromethyl)pyridazine
- Pyridazine, 3-iodo-6-(trifluoromethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Iodo-6-(trifluoromethyl)pyridazine
CAS:3-Iodo-6-(trifluoromethyl)pyridazine is an antimicrobial agent that inhibits the growth of bacteria by inhibiting the fatty acid synthesis. This drug has been shown to be effective against ulceration caused by the murine sarcoma virus, HIV infection, and inflammatory bowel disease. 3-Iodo-6-(trifluoromethyl)pyridazine has also been used in experimental models as a dietary supplement for treatment of symptoms of bowel diseases, such as ulcerative colitis and Crohn's disease. With respect to cancer, 3-iodo-6-(trifluoromethyl)pyridazine has been shown to inhibit tumor perfusion and reduce tumor size. The mechanism by which this drug exerts its effect on cancer cells is not well understood but may involve inhibition of protein synthesis or suppression of angiogenesis.Formula:C5H2F3IN2Purity:Min. 95%Molecular weight:273.98 g/mol
