CymitQuimica logo

CAS 1206524-34-6

:

3-Amino-N-[2-[(trifluoromethyl)thio]ethyl]benzenesulfonamide

Description:
3-Amino-N-[2-[(trifluoromethyl)thio]ethyl]benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of the amino group indicates potential for hydrogen bonding, enhancing its solubility in polar solvents. The trifluoromethyl group contributes to the compound's lipophilicity and can influence its biological activity, making it a subject of interest in medicinal chemistry. The ethyl chain linking the trifluoromethylthio group to the benzenesulfonamide structure adds to the molecular complexity and may affect the compound's pharmacokinetics. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the presence of the trifluoromethylthio moiety. Overall, 3-Amino-N-[2-[(trifluoromethyl)thio]ethyl]benzenesulfonamide represents a unique structure that may have applications in pharmaceuticals, particularly in the development of new therapeutic agents.
Formula:C9H11F3N2O2S2
InChI:InChI=1S/C9H11F3N2O2S2/c10-9(11,12)17-5-4-14-18(15,16)8-3-1-2-7(13)6-8/h1-3,6,14H,4-5,13H2
InChI key:InChIKey=FERSCWQIRZIGNF-UHFFFAOYSA-N
SMILES:S(NCCSC(F)(F)F)(=O)(=O)C1=CC(N)=CC=C1
Synonyms:
  • 3-Amino-N-[2-[(trifluoromethyl)thio]ethyl]benzenesulfonamide
  • Benzenesulfonamide, 3-amino-N-[2-[(trifluoromethyl)thio]ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.