CymitQuimica logo

CAS 1206540-59-1

:

3,3-Difluoro-4-(phenylmethoxy)piperidine

Description:
3,3-Difluoro-4-(phenylmethoxy)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of two fluorine atoms at the 3-position contributes to its unique reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The 4-position features a phenylmethoxy group, which enhances the compound's lipophilicity and may influence its binding affinity to biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential for interactions with various biological systems, making it of interest in drug discovery. Additionally, the presence of fluorine atoms can improve metabolic stability and alter pharmacokinetic properties. As with many fluorinated compounds, it may also exhibit unique electronic properties due to the electronegative nature of fluorine. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C12H15F2NO
InChI:InChI=1S/C12H15F2NO/c13-12(14)9-15-7-6-11(12)16-8-10-4-2-1-3-5-10/h1-5,11,15H,6-9H2
InChI key:InChIKey=OBLKTQVTONDPQK-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2C(F)(F)CNCC2
Synonyms:
  • Piperidine, 3,3-difluoro-4-(phenylmethoxy)-
  • 3,3-Difluoro-4-(phenylmethoxy)piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.