CAS 120657-54-7
:Benzoic acid, isodecyl ester
Description:
Benzoic acid, isodecyl ester, is an organic compound classified as an ester, formed from the reaction of benzoic acid and isodecanol. It typically appears as a colorless to pale yellow liquid with a characteristic odor. This compound is known for its low volatility and relatively high molecular weight, which contributes to its stability and solubility in various organic solvents. It is often used as a plasticizer and a lubricant in industrial applications, enhancing the flexibility and durability of materials. Additionally, benzoic acid esters can exhibit antimicrobial properties, making them useful in food preservation and cosmetic formulations. The compound's structure features a benzoate group attached to an isodecyl chain, which influences its physical and chemical properties, such as melting point, boiling point, and viscosity. Safety data indicates that while it is generally considered low in toxicity, appropriate handling and safety measures should be observed to minimize exposure. Overall, benzoic acid, isodecyl ester is valued for its functional properties in various chemical and industrial applications.
Formula:C17H26O2
InChI:InChI=1/C17H26O2/c1-15(2)11-7-4-3-5-10-14-19-17(18)16-12-8-6-9-13-16/h6,8-9,12-13,15H,3-5,7,10-11,14H2,1-2H3
Synonyms:- B 510
- 8-methylnonyl benzoate
- Benzoic acid, isodecyl ester
- Hi-Ester B 510
- Isodecyl benzoate
- Benzoflex 131
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
