CAS 120659-40-7
:Decanoic acid, 3-hydroxy-, homopolymer
Description:
Decanoic acid, 3-hydroxy-, homopolymer, identified by CAS number 120659-40-7, is a synthetic polymer derived from the polymerization of decanoic acid, which is a medium-chain fatty acid. This substance exhibits characteristics typical of polyesters, including good thermal stability and resistance to degradation. It is generally hydrophobic due to its long hydrocarbon chains, which contributes to its potential applications in various fields, such as coatings, adhesives, and as a plasticizer. The presence of hydroxyl groups in its structure enhances its reactivity, allowing for further functionalization and modification. Additionally, the polymer's molecular weight and degree of polymerization can influence its physical properties, such as viscosity and mechanical strength. Its biodegradability is an important characteristic, making it an attractive option for environmentally friendly applications. Overall, Decanoic acid, 3-hydroxy-, homopolymer is valued for its versatility and potential in sustainable materials development.
Formula:(C10H20O3)x
InChI:InChI=1S/C10H20O3/c1-2-3-4-5-6-7-9(11)8-10(12)13/h9,11H,2-8H2,1H3,(H,12,13)
InChI key:InChIKey=FYSSBMZUBSBFJL-UHFFFAOYSA-N
SMILES:C(C(CC(O)=O)O)CCCCCC
Synonyms:- Decanoic acid, 3-hydroxy-, homopolymer
- 3-Hydroxydecanoic acid polymer
- Capric acid, hydroxy-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
