CAS 1206641-46-4
:1-[[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-piperidinecarbonitrile
Description:
1-[[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-piperidinecarbonitrile is a chemical compound characterized by its complex structure, which includes a piperidine ring and a boron-containing moiety. The presence of the tetramethyl-1,3,2-dioxaborolane group suggests that this compound may exhibit unique reactivity, particularly in organoboron chemistry, which is often utilized in cross-coupling reactions and as intermediates in organic synthesis. The piperidine ring contributes to the compound's potential biological activity, as piperidine derivatives are known for their pharmacological properties. Additionally, the nitrile functional group may enhance the compound's polarity and solubility in various solvents, influencing its behavior in chemical reactions and applications. Overall, this compound's structural features indicate potential utility in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.
Formula:C19H27BN2O2
InChI:InChI=1S/C19H27BN2O2/c1-18(2)19(3,4)24-20(23-18)17-7-5-16(6-8-17)14-22-11-9-15(13-21)10-12-22/h5-8,15H,9-12,14H2,1-4H3
InChI key:InChIKey=RKSRYKKUHKMUPS-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(CN3CCC(C#N)CC3)C=C2
Synonyms:- 4-Piperidinecarbonitrile, 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-
- 1-[[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-piperidinecarbonitrile
- 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)piperidine-4-carbonitrile
- 1-{[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl}piperidine-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-{[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl}piperidine-4-carbonitrile
CAS:Formula:C19H27BN2O2Molecular weight:326.2409
