CAS 120667-15-4

4-Phosphonophenylglycine

Description:

4-Phosphonophenylglycine, with the CAS number 120667-15-4, is an amino acid derivative characterized by the presence of a phosphonic acid group attached to a phenyl ring. This compound typically exhibits properties associated with both amino acids and phosphonates, making it of interest in various fields, including biochemistry and pharmaceuticals. It is often utilized as a building block in the synthesis of more complex molecules and can act as a ligand in coordination chemistry. The phosphonic acid moiety imparts unique reactivity and solubility characteristics, enhancing its potential applications in agrochemicals and as a biochemical probe. Additionally, 4-Phosphonophenylglycine may exhibit biological activity, influencing pathways related to neurotransmission or cellular signaling, although specific biological effects can vary based on the context of its use. Its structural features, including the amino and phosphonic groups, contribute to its potential as a versatile compound in research and development.

Formula: C₈H₁₀NO₅P

InChI: InChI=1/C8H10NO5P/c10-8(11)5-9-6-1-3-7(4-2-6)15(12,13)14/h1-4,9H,5H2,(H,10,11)(H2,12,13,14)

SMILES: c1cc(ccc1NCC(=O)O)P(=O)(O)O

Synonyms:

• (Rs)-Phosphonophenylglycine
• (Rs)-Ppg
• (Rs)-4-Phosphonophenylglycine
• 2-[(4-Phosphonophenyl)Amino]Acetic Acid

(RS)-PPG

CAS: 120667-15-4

(RS)-PPG: Potent, selective III mGluRs agonist; EC50s: hmGluR4a 5.2μM, hmGluR6 4.7μM, hmGluR7b 185μM, hmGluR8a 0.2μM; neuroprotective, anticonvulsive.

Formula: C₈H₁₀NO₅P

Purity: 98%

Color and Shape: Solid

Molecular weight: 231.14

Ref: TM-T12772