CymitQuimica logo

CAS 1206673-54-2

:

α-(Trifluoromethyl)-5-thiazolemethanol

Description:
α-(Trifluoromethyl)-5-thiazolemethanol is a chemical compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The trifluoromethyl group (-CF3) attached to the α-position of the thiazole significantly influences the compound's chemical properties, including its reactivity and polarity. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It exhibits moderate solubility in polar solvents due to the presence of the hydroxymethyl group (-CH2OH), which can engage in hydrogen bonding. The trifluoromethyl group enhances the compound's lipophilicity and can also affect its biological activity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the thiazole moiety is known for its role in various biological activities, including antimicrobial and antifungal properties. Overall, α-(Trifluoromethyl)-5-thiazolemethanol is a compound of interest for further research in both synthetic and applied chemistry contexts.
Formula:C5H4F3NOS
InChI:InChI=1S/C5H4F3NOS/c6-5(7,8)4(10)3-1-9-2-11-3/h1-2,4,10H
InChI key:InChIKey=QQQFVSKBXFHSNG-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(O)C1=CN=CS1
Synonyms:
  • α-(Trifluoromethyl)-5-thiazolemethanol
  • 2,2,2-Trifluoro-1-(thiazol-5-yl)ethanol
  • 5-Thiazolemethanol, α-(trifluoromethyl)-
  • 2,2,2-Trifluoro-1-(1,3-thiazol-5-yl)ethan-1-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.