
CAS 1206675-32-2
:Hydrazine, (2-methylcyclohexyl)-, hydrochloride (1:1)
Description:
Hydrazine, (2-methylcyclohexyl)-, hydrochloride (1:1) is a chemical compound characterized by its hydrazine functional group, which is known for its high reactivity and potential as a reducing agent. This compound features a 2-methylcyclohexyl group, contributing to its unique structural properties and potential applications in organic synthesis. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in polar solvents, particularly water. The presence of the hydrochloride indicates that it can release hydrazine upon dissolution, which is important for its reactivity. Hydrazine derivatives are often utilized in various fields, including pharmaceuticals, agriculture, and as propellants in rocket fuel. However, it is essential to handle this compound with care due to its toxicity and potential health hazards, including its classification as a carcinogen. Proper safety protocols should be followed when working with this substance in laboratory or industrial settings.
Formula:C7H16N2·ClH
InChI:InChI=1S/C7H16N2.ClH/c1-6-4-2-3-5-7(6)9-8;/h6-7,9H,2-5,8H2,1H3;1H
InChI key:InChIKey=HNIVODRWOCNZEI-UHFFFAOYSA-N
SMILES:N(N)C1C(C)CCCC1.Cl
Synonyms:- (2-Methylcyclohexyl)hydrazine hydrochloride
- Hydrazine, (2-methylcyclohexyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.