CAS 1206734-95-3

3-[(2-O-Acetyl-β-D-glucopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one

Description:

The chemical substance known as "3-[(2-O-Acetyl-β-D-glucopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one," with the CAS number 1206734-95-3, is a flavonoid glycoside. This compound features a flavone backbone, characterized by a chromone structure with hydroxyl groups at the 5 and 7 positions, contributing to its potential antioxidant properties. The presence of the β-D-glucopyranosyl moiety, which is acetylated at the 2-position, enhances its solubility and bioavailability. The 4-hydroxyphenyl group attached to the benzopyran structure may impart additional biological activities, including anti-inflammatory and anticancer effects. This compound is of interest in pharmacological research due to its potential health benefits, including its role in modulating oxidative stress and inflammation. Its structural complexity and functional groups suggest that it may interact with various biological targets, making it a candidate for further studies in medicinal chemistry and natural product research.

Formula: C₂₃H₂₂O₁₂

InChI: InChI=1S/C23H22O12/c1-9(25)32-22-19(31)17(29)15(8-24)34-23(22)35-21-18(30)16-13(28)6-12(27)7-14(16)33-20(21)10-2-4-11(26)5-3-10/h2-7,15,17,19,22-24,26-29,31H,8H2,1H3/t15-,17-,19+,22-,23+/m1/s1

InChI key: InChIKey=MWEQHAGXLGTSKL-OPCQMSRDSA-N

SMILES: O(C1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC=C(O)C=C3)[C@H]4[C@H](OC(C)=O)[C@@H](O)[C@H](O)[C@@H](CO)O4

Synonyms:

• 3-[(2-O-Acetyl-β-D-glucopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
• 2′′-Acetylastragalin
• 4H-1-Benzopyran-4-one, 3-[(2-O-acetyl-β-D-glucopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-

2''-Acetylastragalin

CAS: 1206734-95-3

2''-Acetylastragalin is a natural product from Astragalus membranaceus.

Formula: C₂₃H₂₂O₁₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 490.41

Ref: TM-TN2748

2''-Acetylastragalin

CAS: 1206734-95-3

Formula: C₂₃H₂₂O₁₂

Purity: 95%~99%

Color and Shape: Yellow powder

Molecular weight: 490.417

Ref: BP-SBP02633

2''-Acetylastragalin

CAS: 1206734-95-3

2''-Acetylastragalin is a natural flavonoid compound, which is a secondary metabolite commonly found in various plants. This compound is typically derived from species within the Fabaceae family, particularly from Astragalus plants. As a naturally occurring flavonoid, 2''-Acetylastragalin involves complex biochemical pathways, acting primarily as an antioxidant. It is known for its ability to scavenge free radicals and can influence various signaling pathways related to oxidative stress.

Formula: C₂₃H₂₂O₁₂

Purity: Min. 95%

Molecular weight: 490.4 g/mol

Ref: 3D-GYB73495