CAS 120674-92-2

Bis(decafluoro-2-trifluoromethyl-2-pentyl)mercury

Description:

Bis(decafluoro-2-trifluoromethyl-2-pentyl)mercury, with the CAS number 120674-92-2, is an organomercury compound characterized by its unique structure, which includes a mercury atom bonded to two decafluoro-2-trifluoromethyl-2-pentyl groups. This compound is notable for its high degree of fluorination, which imparts significant hydrophobic and lipophobic properties, making it resistant to degradation in various environmental conditions. The presence of fluorinated alkyl chains contributes to its potential applications in specialized fields, such as in the development of advanced materials or as a reagent in organic synthesis. However, due to the toxicity associated with mercury compounds, including potential bioaccumulation and environmental persistence, safety precautions are essential when handling this substance. Its chemical behavior is influenced by the strong C-F bonds, which can affect reactivity and stability. Overall, while bis(decafluoro-2-trifluoromethyl-2-pentyl)mercury exhibits interesting chemical properties, its use is heavily regulated due to the health and environmental risks associated with mercury.

Formula: C₁₂F₂₆Hg

InChI: InChI=1/2C6F13.Hg/c2*7-2(8,5(15,16)6(17,18)19)1(3(9,10)11)4(12,13)14;/rC12F26Hg/c13-3(14,5(17,18)11(33,34)35)1(7(21,22)23,8(24,25)26)39-2(9(27,28)29,10(30,31)32)4(15,16)6(19,20)12(36,37)38

SMILES: C(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)(C(F)(F)F)[Hg]C(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)C(F)(F)F

Synonyms:

• Bis[perfluoro(1,1-dimethylbutyl)]mercury
• Bis[2,2,3,3,4,4,4-Heptafluoro-1,1-Bis(Trifluoromethyl)Butyl]Mercury