CAS 1206775-56-5

5-Bromo-6-methoxy-2-pyridineacetonitrile

Description:

5-Bromo-6-methoxy-2-pyridineacetonitrile is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methoxy group at the 6-position contributes to its unique reactivity and properties. The acetonitrile functional group, attached to the 2-position of the pyridine ring, enhances its polarity and solubility in polar solvents. This compound is typically used in organic synthesis and medicinal chemistry, where it may serve as an intermediate in the development of pharmaceuticals or agrochemicals. Its structure suggests potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of both halogen and methoxy substituents can influence its electronic properties, making it a candidate for further studies in material science or as a ligand in coordination chemistry. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.

Formula: C₈H₇BrN₂O

InChI: InChI=1S/C8H7BrN2O/c1-12-8-7(9)3-2-6(11-8)4-5-10/h2-3H,4H2,1H3

InChI key: InChIKey=AKNKBQHMTURBCC-UHFFFAOYSA-N

SMILES: O(C)C=1N=C(CC#N)C=CC1Br

Synonyms:

• 5-Bromo-6-methoxy-2-pyridineacetonitrile
• 2-Pyridineacetonitrile, 5-bromo-6-methoxy-
• 2-(5-Bromo-6-methoxypyridin-2-yl)acetonitrile