CAS 1206825-36-6
:rel-N-Methyl-N-[(3R,4R)-4-methyl-3-piperidinyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Description:
Rel-N-Methyl-N-[(3R,4R)-4-methyl-3-piperidinyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine is a chemical compound characterized by its complex structure, which includes a pyrrolo[2,3-d]pyrimidine core and a piperidine moiety. This compound is typically classified as a small organic molecule and may exhibit properties relevant to medicinal chemistry, particularly in the context of drug development. Its specific stereochemistry, indicated by the (3R,4R) configuration, suggests that it may interact with biological targets in a stereoselective manner, potentially influencing its pharmacological profile. The presence of the N-methyl group may enhance lipophilicity, affecting its absorption and distribution in biological systems. Additionally, the compound's unique structural features may contribute to its binding affinity and selectivity for certain receptors or enzymes, making it a candidate for further investigation in therapeutic applications. As with many compounds in this category, understanding its solubility, stability, and reactivity is crucial for assessing its potential uses in research and medicine.
Formula:C13H19N5
InChI:InChI=1/C13H19N5/c1-9-3-5-14-7-11(9)18(2)13-10-4-6-15-12(10)16-8-17-13/h4,6,8-9,11,14H,3,5,7H2,1-2H3,(H,15,16,17)/t9-,11+/s2
InChI key:InChIKey=XRIARWQZLGCQDM-UMFDPSGLNA-N
SMILES:N(C)(C1=C2C(NC=C2)=NC=N1)[C@H]3[C@@H](C)CCNC3
Synonyms:- 7H-Pyrrolo[2,3-d]pyrimidin-4-amine, N-methyl-N-[(3R,4R)-4-methyl-3-piperidinyl]-, rel-
- rel-N-Methyl-N-[(3R,4R)-4-methyl-3-piperidinyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine
- Tofatinib Impurity 3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
