CAS 120686-20-6

1,1-Dimethylethyl 3-amino-2-methylbutanoate

Description:

1,1-Dimethylethyl 3-amino-2-methylbutanoate, also known by its CAS number 120686-20-6, is an organic compound characterized by the presence of an amino group and an ester functional group. This compound features a branched structure, which contributes to its unique chemical properties. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric hindrance, potentially influencing its reactivity and interactions with other molecules. The amino group suggests that it may participate in hydrogen bonding, which can affect its solubility in various solvents. Additionally, the methyl groups in the structure can impact its overall polarity and stability. This compound may be of interest in various fields, including pharmaceuticals and organic synthesis, due to its potential biological activity and utility as a building block in chemical reactions. However, specific applications and biological effects would require further investigation and research to fully understand its behavior in different environments.

Formula: C₉H₁₉NO₂

InChI: InChI=1S/C9H19NO2/c1-6(7(2)10)8(11)12-9(3,4)5/h6-7H,10H2,1-5H3

InChI key: InChIKey=JEMLZWXFJMEBLE-UHFFFAOYSA-N

SMILES: C(C(C(C)N)C)(OC(C)(C)C)=O

Synonyms:

• 1,1-Dimethylethyl 3-amino-2-methylbutanoate
• Butanoic acid, 3-amino-2-methyl-, 1,1-dimethylethyl ester