CAS 1206969-01-8
:3-[(2-Phenylethyl)sulfonyl]pyrrolidine
Description:
3-[(2-Phenylethyl)sulfonyl]pyrrolidine is a chemical compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The compound features a sulfonyl group attached to a 2-phenylethyl moiety, contributing to its unique properties. The presence of the sulfonyl group enhances the compound's polarity and solubility in various solvents, making it suitable for diverse applications in organic synthesis and medicinal chemistry. The phenylethyl group can influence the compound's biological activity, potentially affecting its interactions with biological targets. This compound may exhibit interesting pharmacological properties, although specific biological activities would depend on further empirical studies. Its molecular structure suggests potential for use in drug development, particularly in the design of compounds targeting neurological or psychiatric conditions, given the structural motifs involved. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the sulfonyl group, which can be reactive under certain conditions.
Formula:C12H17NO2S
InChI:InChI=1S/C12H17NO2S/c14-16(15,12-6-8-13-10-12)9-7-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2
InChI key:InChIKey=LYOBDBAPSLWXGY-UHFFFAOYSA-N
SMILES:S(CCC1=CC=CC=C1)(=O)(=O)C2CCNC2
Synonyms:- 3-[(2-Phenylethyl)sulfonyl]pyrrolidine
- Pyrrolidine, 3-[(2-phenylethyl)sulfonyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(Phenethylsulfonyl)pyrrolidine
CAS:<p>3-(Phenethylsulfonyl)pyrrolidine</p>Molecular weight:239.33g/mol
